C11H17NO3 — CID 131376130
3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]benzene-1,2-diol (PubChem CID 131376130) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]benzene-1,2-diol.
| Compound Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 131376130 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]benzene-1,2-diol |
| SMILES | CC(C)(CO)[C@@H](N)c1cccc(O)c1O |
| InChI | InChI=1S/C11H17NO3/c1-11(2,6-13)10(12)7-4-3-5-8(14)9(7)15/h3-5,10,13-15H,6,12H2,1-2H3/t10-/m0/s1 |
| InChIKey | QMRHULLLFVDBAZ-JTQLQIEISA-N |
| XLogP | 1.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|