C11H16ClNO — CID 10330849
(3S)-3-amino-3-(2-chlorophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 10330849) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is (3S)-3-amino-3-(2-chlorophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | (3S)-3-amino-3-(2-chlorophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 10330849 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (3S)-3-amino-3-(2-chlorophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)[C@H](N)c1ccccc1Cl |
| InChI | InChI=1S/C11H16ClNO/c1-11(2,7-14)10(13)8-5-3-4-6-9(8)12/h3-6,10,14H,7,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | QQMGZFCEYMAQSQ-SNVBAGLBSA-N |
| XLogP | 2.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |