C11H17ClN2O — CID 171251102
(3S)-3-amino-3-(2-amino-5-chlorophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 171251102) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is (3S)-3-amino-3-(2-amino-5-chlorophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | (3S)-3-amino-3-(2-amino-5-chlorophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 171251102 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3S)-3-amino-3-(2-amino-5-chlorophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)[C@@H](N)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C11H17ClN2O/c1-11(2,6-15)10(14)8-5-7(12)3-4-9(8)13/h3-5,10,15H,6,13-14H2,1-2H3/t10-/m0/s1 |
| InChIKey | PCIWMZGHEWFDKR-JTQLQIEISA-N |
| XLogP | 1.94 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|