C11H15BrClNO — CID 131513048
(3S)-3-amino-3-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 131513048) has the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. Its IUPAC name is (3S)-3-amino-3-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | (3S)-3-amino-3-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 131513048 |
| Molecular Formula | C11H15BrClNO |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | (3S)-3-amino-3-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)[C@H](N)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H15BrClNO/c1-11(2,6-15)10(14)8-5-7(12)3-4-9(8)13/h3-5,10,15H,6,14H2,1-2H3/t10-/m1/s1 |
| InChIKey | BBHKJNWCRIHRHV-SNVBAGLBSA-N |
| XLogP | 3.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |