C11H14BrClO — CID 115796560
1-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 115796560) has the molecular formula C11H14BrClO and a molecular weight of 277.59 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115796560 |
| Molecular Formula | C11H14BrClO |
| Molecular Weight | 277.59 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H14BrClO/c1-11(2,3)10(14)8-6-7(12)4-5-9(8)13/h4-6,10,14H,1-3H3 |
| InChIKey | UCXSHQYTXUVCGP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |