C11H16BrNO — CID 82703334
1-(2-amino-5-bromophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 82703334) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 1-(2-amino-5-bromophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(2-amino-5-bromophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 82703334 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(2-amino-5-bromophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C11H16BrNO/c1-11(2,3)10(14)8-6-7(12)4-5-9(8)13/h4-6,10,14H,13H2,1-3H3 |
| InChIKey | WPZMKXNMNTXGIT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|