C11H18ClFN2O2 — CID 171257404
2-amino-6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-fluorophenol;hydrochloride (PubChem CID 171257404) has the molecular formula C11H18ClFN2O2 and a molecular weight of 264.73 g/mol. Its IUPAC name is 2-amino-6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-fluorophenol;hydrochloride.
| Compound Name | 2-amino-6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257404 |
| Molecular Formula | C11H18ClFN2O2 |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-amino-6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-fluorophenol;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](N)c1ccc(F)c(N)c1O.Cl |
| InChI | InChI=1S/C11H17FN2O2.ClH/c1-11(2,5-15)10(14)6-3-4-7(12)8(13)9(6)16;/h3-4,10,15-16H,5,13-14H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | DGIWOIJXGVHFFD-PPHPATTJSA-N |
| XLogP | 1.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|