C11H14ClF3N2O3 — CID 171257379
ethyl (3S)-3-amino-3-(3-amino-4-fluoro-2-hydroxyphenyl)-2,2-difluoropropanoate;hydrochloride (PubChem CID 171257379) has the molecular formula C11H14ClF3N2O3 and a molecular weight of 314.69 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3-amino-4-fluoro-2-hydroxyphenyl)-2,2-difluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3-amino-4-fluoro-2-hydroxyphenyl)-2,2-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171257379 |
| Molecular Formula | C11H14ClF3N2O3 |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3-amino-4-fluoro-2-hydroxyphenyl)-2,2-difluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1ccc(F)c(N)c1O.Cl |
| InChI | InChI=1S/C11H13F3N2O3.ClH/c1-2-19-10(18)11(13,14)9(16)5-3-4-6(12)7(15)8(5)17;/h3-4,9,17H,2,15-16H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | BXTZWGZBCOVCGL-FVGYRXGTSA-N |
| XLogP | 1.73 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|