C11H11F4NO3 — CID 171256489
ethyl (3S)-3-amino-3-(3,6-difluoro-2-hydroxyphenyl)-2,2-difluoropropanoate (PubChem CID 171256489) has the molecular formula C11H11F4NO3 and a molecular weight of 281.21 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3,6-difluoro-2-hydroxyphenyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(3,6-difluoro-2-hydroxyphenyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171256489 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3,6-difluoro-2-hydroxyphenyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1c(F)ccc(F)c1O |
| InChI | InChI=1S/C11H11F4NO3/c1-2-19-10(18)11(14,15)9(16)7-5(12)3-4-6(13)8(7)17/h3-4,9,17H,2,16H2,1H3/t9-/m0/s1 |
| InChIKey | YVPOIUDAFYUKLC-VIFPVBQESA-N |
| XLogP | 1.87 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|