C12H11F6NO3 — CID 171255743
ethyl (3R)-3-amino-2,2-difluoro-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate (PubChem CID 171255743) has the molecular formula C12H11F6NO3 and a molecular weight of 331.21 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2,2-difluoro-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (3R)-3-amino-2,2-difluoro-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171255743 |
| Molecular Formula | C12H11F6NO3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | ethyl (3R)-3-amino-2,2-difluoro-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1c(C(F)(F)F)ccc(F)c1O |
| InChI | InChI=1S/C12H11F6NO3/c1-2-22-10(21)11(14,15)9(19)7-5(12(16,17)18)3-4-6(13)8(7)20/h3-4,9,20H,2,19H2,1H3/t9-/m1/s1 |
| InChIKey | WAKRSPGSKHCKOO-SECBINFHSA-N |
| XLogP | 2.75 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|