C11H11Cl2F4NO2 — CID 171249379
ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoropropanoate;hydrochloride (PubChem CID 171249379) has the molecular formula C11H11Cl2F4NO2 and a molecular weight of 336.11 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171249379 |
| Molecular Formula | C11H11Cl2F4NO2 |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)-2,2-difluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1c(F)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C11H10ClF4NO2.ClH/c1-2-19-10(18)11(15,16)9(17)7-6(13)4-3-5(12)8(7)14;/h3-4,9H,2,17H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | RSTFBWCXKJPTFU-FVGYRXGTSA-N |
| XLogP | 3.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|