C12H13ClF3NO5 — CID 171258695
3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-4-fluoro-2-hydroxybenzoic acid;hydrochloride (PubChem CID 171258695) has the molecular formula C12H13ClF3NO5 and a molecular weight of 343.69 g/mol. Its IUPAC name is 3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-4-fluoro-2-hydroxybenzoic acid;hydrochloride.
| Compound Name | 3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-4-fluoro-2-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171258695 |
| Molecular Formula | C12H13ClF3NO5 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-4-fluoro-2-hydroxybenzoic acid;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1c(F)ccc(C(=O)O)c1O.Cl |
| InChI | InChI=1S/C12H12F3NO5.ClH/c1-2-21-11(20)12(14,15)9(16)7-6(13)4-3-5(8(7)17)10(18)19;/h3-4,9,17H,2,16H2,1H3,(H,18,19);1H/t9-;/m0./s1 |
| InChIKey | CTZKQUOAPGIICY-FVGYRXGTSA-N |
| XLogP | 1.85 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|