C13H16ClF2NO5 — CID 171258525
3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-2-hydroxy-5-methylbenzoic acid;hydrochloride (PubChem CID 171258525) has the molecular formula C13H16ClF2NO5 and a molecular weight of 339.72 g/mol. Its IUPAC name is 3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-2-hydroxy-5-methylbenzoic acid;hydrochloride.
| Compound Name | 3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-2-hydroxy-5-methylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171258525 |
| Molecular Formula | C13H16ClF2NO5 |
| Molecular Weight | 339.72 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-[(1S)-1-amino-3-ethoxy-2,2-difluoro-3-oxopropyl]-2-hydroxy-5-methylbenzoic acid;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1cc(C)cc(C(=O)O)c1O.Cl |
| InChI | InChI=1S/C13H15F2NO5.ClH/c1-3-21-12(20)13(14,15)10(16)7-4-6(2)5-8(9(7)17)11(18)19;/h4-5,10,17H,3,16H2,1-2H3,(H,18,19);1H/t10-;/m0./s1 |
| InChIKey | VWFDLTUTAGQBHA-PPHPATTJSA-N |
| XLogP | 2.02 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|