C12H14BrF2NO4 — CID 171250660
ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,2-difluoropropanoate (PubChem CID 171250660) has the molecular formula C12H14BrF2NO4 and a molecular weight of 354.15 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171250660 |
| Molecular Formula | C12H14BrF2NO4 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1cc(Br)cc(OC)c1O |
| InChI | InChI=1S/C12H14BrF2NO4/c1-3-20-11(18)12(14,15)10(16)7-4-6(13)5-8(19-2)9(7)17/h4-5,10,17H,3,16H2,1-2H3/t10-/m0/s1 |
| InChIKey | HLNPLYKFYFMXPL-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|