C13H17F2NO4 — CID 171246682
ethyl (3S)-3-amino-3-(2,4-dimethoxyphenyl)-2,2-difluoropropanoate (PubChem CID 171246682) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2,4-dimethoxyphenyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2,4-dimethoxyphenyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171246682 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2,4-dimethoxyphenyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H17F2NO4/c1-4-20-12(17)13(14,15)11(16)9-6-5-8(18-2)7-10(9)19-3/h5-7,11H,4,16H2,1-3H3/t11-/m0/s1 |
| InChIKey | QXMBOKGBEBEWOE-NSHDSACASA-N |
| XLogP | 1.90 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |