C11H12Br2F2N2O2 — CID 171246062
ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropanoate (PubChem CID 171246062) has the molecular formula C11H12Br2F2N2O2 and a molecular weight of 402.03 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171246062 |
| Molecular Formula | C11H12Br2F2N2O2 |
| Molecular Weight | 402.03 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C11H12Br2F2N2O2/c1-2-19-10(18)11(14,15)9(17)6-3-5(12)4-7(13)8(6)16/h3-4,9H,2,16-17H2,1H3/t9-/m0/s1 |
| InChIKey | MALSBGFHSAUPQZ-VIFPVBQESA-N |
| XLogP | 2.99 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.03 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|