C11H11ClF5NO2 — CID 171249723
ethyl (3S)-3-amino-2,2-difluoro-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride (PubChem CID 171249723) has the molecular formula C11H11ClF5NO2 and a molecular weight of 319.66 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2,2-difluoro-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2,2-difluoro-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171249723 |
| Molecular Formula | C11H11ClF5NO2 |
| Molecular Weight | 319.66 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | ethyl (3S)-3-amino-2,2-difluoro-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1cc(F)c(F)cc1F.Cl |
| InChI | InChI=1S/C11H10F5NO2.ClH/c1-2-19-10(18)11(15,16)9(17)5-3-7(13)8(14)4-6(5)12;/h3-4,9H,2,17H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | ZPSXEHKTZNCALQ-FVGYRXGTSA-N |
| XLogP | 2.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|