C11H14ClF2NO4 — CID 171246311
ethyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)-2,2-difluoropropanoate;hydrochloride (PubChem CID 171246311) has the molecular formula C11H14ClF2NO4 and a molecular weight of 297.69 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)-2,2-difluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)-2,2-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171246311 |
| Molecular Formula | C11H14ClF2NO4 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)-2,2-difluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1ccc(O)cc1O.Cl |
| InChI | InChI=1S/C11H13F2NO4.ClH/c1-2-18-10(17)11(12,13)9(14)7-4-3-6(15)5-8(7)16;/h3-5,9,15-16H,2,14H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | UUBNKJXTOZGOHY-FVGYRXGTSA-N |
| XLogP | 1.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|