C15H23ClF2N2O3 — CID 171245470
ethyl (3S)-3-amino-3-[4-(diethylamino)-2-hydroxyphenyl]-2,2-difluoropropanoate;hydrochloride (PubChem CID 171245470) has the molecular formula C15H23ClF2N2O3 and a molecular weight of 352.81 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[4-(diethylamino)-2-hydroxyphenyl]-2,2-difluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-[4-(diethylamino)-2-hydroxyphenyl]-2,2-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171245470 |
| Molecular Formula | C15H23ClF2N2O3 |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | ethyl (3S)-3-amino-3-[4-(diethylamino)-2-hydroxyphenyl]-2,2-difluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1ccc(N(CC)CC)cc1O.Cl |
| InChI | InChI=1S/C15H22F2N2O3.ClH/c1-4-19(5-2)10-7-8-11(12(20)9-10)13(18)15(16,17)14(21)22-6-3;/h7-9,13,20H,4-6,18H2,1-3H3;1H/t13-;/m0./s1 |
| InChIKey | DBIOGPNSUIUHLR-ZOWNYOTGSA-N |
| XLogP | 2.86 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|