C12H19ClF2N2O — CID 171238756
2-[(1R)-1-amino-2,2-difluoroethyl]-5-(diethylamino)phenol;hydrochloride (PubChem CID 171238756) has the molecular formula C12H19ClF2N2O and a molecular weight of 280.75 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoroethyl]-5-(diethylamino)phenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-5-(diethylamino)phenol;hydrochloride |
|---|---|
| PubChem CID | 171238756 |
| Molecular Formula | C12H19ClF2N2O |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-5-(diethylamino)phenol;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@@H](N)C(F)F)c(O)c1.Cl |
| InChI | InChI=1S/C12H18F2N2O.ClH/c1-3-16(4-2)8-5-6-9(10(17)7-8)11(15)12(13)14;/h5-7,11-12,17H,3-4,15H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | IINZKUAZFNDTSO-RFVHGSKJSA-N |
| XLogP | 2.93 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|