C17H31ClN2O2 — CID 171266478
2-[(1S,2R)-1-amino-2-hydroxy-5-methylhexyl]-5-(diethylamino)phenol;hydrochloride (PubChem CID 171266478) has the molecular formula C17H31ClN2O2 and a molecular weight of 330.90 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-5-methylhexyl]-5-(diethylamino)phenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-5-methylhexyl]-5-(diethylamino)phenol;hydrochloride |
|---|---|
| PubChem CID | 171266478 |
| Molecular Formula | C17H31ClN2O2 |
| Molecular Weight | 330.90 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-5-methylhexyl]-5-(diethylamino)phenol;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@H](N)[C@H](O)CCC(C)C)c(O)c1.Cl |
| InChI | InChI=1S/C17H30N2O2.ClH/c1-5-19(6-2)13-8-9-14(16(21)11-13)17(18)15(20)10-7-12(3)4;/h8-9,11-12,15,17,20-21H,5-7,10,18H2,1-4H3;1H/t15-,17+;/m1./s1 |
| InChIKey | QEKWKEGJMFTSIA-KALLACGZSA-N |
| XLogP | 3.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|