C13H22ClFN2O — CID 171217392
2-[(1S)-1-amino-3-fluoropropyl]-5-(diethylamino)phenol;hydrochloride (PubChem CID 171217392) has the molecular formula C13H22ClFN2O and a molecular weight of 276.78 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3-fluoropropyl]-5-(diethylamino)phenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-3-fluoropropyl]-5-(diethylamino)phenol;hydrochloride |
|---|---|
| PubChem CID | 171217392 |
| Molecular Formula | C13H22ClFN2O |
| Molecular Weight | 276.78 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-[(1S)-1-amino-3-fluoropropyl]-5-(diethylamino)phenol;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@@H](N)CCF)c(O)c1.Cl |
| InChI | InChI=1S/C13H21FN2O.ClH/c1-3-16(4-2)10-5-6-11(13(17)9-10)12(15)7-8-14;/h5-6,9,12,17H,3-4,7-8,15H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | UERMOSVPQSSBDM-YDALLXLXSA-N |
| XLogP | 3.02 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|