C17H29ClN2O — CID 171217400
2-[(S)-amino(cyclohexyl)methyl]-5-(diethylamino)phenol;hydrochloride (PubChem CID 171217400) has the molecular formula C17H29ClN2O and a molecular weight of 312.89 g/mol. Its IUPAC name is 2-[(S)-amino(cyclohexyl)methyl]-5-(diethylamino)phenol;hydrochloride.
| Compound Name | 2-[(S)-amino(cyclohexyl)methyl]-5-(diethylamino)phenol;hydrochloride |
|---|---|
| PubChem CID | 171217400 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[(S)-amino(cyclohexyl)methyl]-5-(diethylamino)phenol;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@@H](N)C2CCCCC2)c(O)c1.Cl |
| InChI | InChI=1S/C17H28N2O.ClH/c1-3-19(4-2)14-10-11-15(16(20)12-14)17(18)13-8-6-5-7-9-13;/h10-13,17,20H,3-9,18H2,1-2H3;1H/t17-;/m0./s1 |
| InChIKey | NLTYICWXKITGLU-LMOVPXPDSA-N |
| XLogP | 4.24 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|