C10H14ClNO2 — CID 171200126
4-[(R)-amino(cyclopropyl)methyl]benzene-1,3-diol;hydrochloride (PubChem CID 171200126) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 4-[(R)-amino(cyclopropyl)methyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[(R)-amino(cyclopropyl)methyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171200126 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 4-[(R)-amino(cyclopropyl)methyl]benzene-1,3-diol;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(O)cc1O)C1CC1 |
| InChI | InChI=1S/C10H13NO2.ClH/c11-10(6-1-2-6)8-4-3-7(12)5-9(8)13;/h3-6,10,12-13H,1-2,11H2;1H/t10-;/m1./s1 |
| InChIKey | ILVZBPHUGSDEEV-HNCPQSOCSA-N |
| XLogP | 1.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|