C13H20ClNO2 — CID 171200665
2-[(R)-amino(cyclopentyl)methyl]-5-methoxyphenol;hydrochloride (PubChem CID 171200665) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 2-[(R)-amino(cyclopentyl)methyl]-5-methoxyphenol;hydrochloride.
| Compound Name | 2-[(R)-amino(cyclopentyl)methyl]-5-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171200665 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[(R)-amino(cyclopentyl)methyl]-5-methoxyphenol;hydrochloride |
| SMILES | COc1ccc([C@H](N)C2CCCC2)c(O)c1.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-16-10-6-7-11(12(15)8-10)13(14)9-4-2-3-5-9;/h6-9,13,15H,2-5,14H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | FJGJKUNMTBRAND-BTQNPOSSSA-N |
| XLogP | 3.01 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|