C18H22ClF3N2O2 — CID 171245477
2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-(diethylamino)phenol;hydrochloride (PubChem CID 171245477) has the molecular formula C18H22ClF3N2O2 and a molecular weight of 390.83 g/mol. Its IUPAC name is 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-(diethylamino)phenol;hydrochloride.
| Compound Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-(diethylamino)phenol;hydrochloride |
|---|---|
| PubChem CID | 171245477 |
| Molecular Formula | C18H22ClF3N2O2 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-(diethylamino)phenol;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@H](N)c2ccc(OC(F)(F)F)cc2)c(O)c1.Cl |
| InChI | InChI=1S/C18H21F3N2O2.ClH/c1-3-23(4-2)13-7-10-15(16(24)11-13)17(22)12-5-8-14(9-6-12)25-18(19,20)21;/h5-11,17,24H,3-4,22H2,1-2H3;1H/t17-;/m1./s1 |
| InChIKey | KBLFICYZYSRMNR-UNTBIKODSA-N |
| XLogP | 4.61 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|