C14H11F4NO2 — CID 171245952
4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluorophenol (PubChem CID 171245952) has the molecular formula C14H11F4NO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is 4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluorophenol.
| Compound Name | 4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluorophenol |
|---|---|
| PubChem CID | 171245952 |
| Molecular Formula | C14H11F4NO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluorophenol |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1ccc(O)cc1F |
| InChI | InChI=1S/C14H11F4NO2/c15-12-7-9(20)3-6-11(12)13(19)8-1-4-10(5-2-8)21-14(16,17)18/h1-7,13,20H,19H2/t13-/m1/s1 |
| InChIKey | CNJILSHNLAFLRH-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |