C14H10F5NO2 — CID 171256466
6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,3-difluorophenol (PubChem CID 171256466) has the molecular formula C14H10F5NO2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,3-difluorophenol.
| Compound Name | 6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 171256466 |
| Molecular Formula | C14H10F5NO2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,3-difluorophenol |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1ccc(F)c(F)c1O |
| InChI | InChI=1S/C14H10F5NO2/c15-10-6-5-9(13(21)11(10)16)12(20)7-1-3-8(4-2-7)22-14(17,18)19/h1-6,12,21H,20H2/t12-/m1/s1 |
| InChIKey | HYKBRMXLPWJDPD-GFCCVEGCSA-N |
| XLogP | 3.62 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|