C15H10F4N2O2 — CID 171256079
3-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-2-hydroxybenzonitrile (PubChem CID 171256079) has the molecular formula C15H10F4N2O2 and a molecular weight of 326.25 g/mol. Its IUPAC name is 3-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-2-hydroxybenzonitrile.
| Compound Name | 3-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 171256079 |
| Molecular Formula | C15H10F4N2O2 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 3-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-2-hydroxybenzonitrile |
| SMILES | N#Cc1c(F)ccc([C@@H](N)c2ccc(OC(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C15H10F4N2O2/c16-12-6-5-10(14(22)11(12)7-20)13(21)8-1-3-9(4-2-8)23-15(17,18)19/h1-6,13,22H,21H2/t13-/m0/s1 |
| InChIKey | DXTLPYCPHQLNBC-ZDUSSCGKSA-N |
| XLogP | 3.35 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|