C14H11F4NO2 — CID 171239131
2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluorophenol (PubChem CID 171239131) has the molecular formula C14H11F4NO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluorophenol.
| Compound Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluorophenol |
|---|---|
| PubChem CID | 171239131 |
| Molecular Formula | C14H11F4NO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-6-fluorophenol |
| SMILES | N[C@@H](c1ccc(OC(F)(F)F)cc1)c1cccc(F)c1O |
| InChI | InChI=1S/C14H11F4NO2/c15-11-3-1-2-10(13(11)20)12(19)8-4-6-9(7-5-8)21-14(16,17)18/h1-7,12,20H,19H2/t12-/m0/s1 |
| InChIKey | AGVHDGGNCCUNAP-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|