C16H16F3NO — CID 171240516
(S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171240516) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is (S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171240516 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (S)-(2,3-dimethylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | Cc1cccc([C@@H](N)c2ccc(OC(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C16H16F3NO/c1-10-4-3-5-14(11(10)2)15(20)12-6-8-13(9-7-12)21-16(17,18)19/h3-9,15H,20H2,1-2H3/t15-/m0/s1 |
| InChIKey | CUDVMTUZAOOKQL-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |