C15H13F4NO2 — CID 171248230
(R)-(2-fluoro-3-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171248230) has the molecular formula C15H13F4NO2 and a molecular weight of 315.27 g/mol. Its IUPAC name is (R)-(2-fluoro-3-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (R)-(2-fluoro-3-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171248230 |
| Molecular Formula | C15H13F4NO2 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (R)-(2-fluoro-3-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | COc1cccc([C@H](N)c2ccc(OC(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C15H13F4NO2/c1-21-12-4-2-3-11(13(12)16)14(20)9-5-7-10(8-6-9)22-15(17,18)19/h2-8,14H,20H2,1H3/t14-/m1/s1 |
| InChIKey | CAMXUZRRMQXWFD-CQSZACIVSA-N |
| XLogP | 3.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |