C20H26F4O2 — CID 176686233
ethane;2-fluoro-1-methoxy-3-propan-2-ylbenzene;1-methyl-4-(trifluoromethoxy)benzene (PubChem CID 176686233) has the molecular formula C20H26F4O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is ethane;2-fluoro-1-methoxy-3-propan-2-ylbenzene;1-methyl-4-(trifluoromethoxy)benzene.
| Compound Name | ethane;2-fluoro-1-methoxy-3-propan-2-ylbenzene;1-methyl-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 176686233 |
| Molecular Formula | C20H26F4O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | ethane;2-fluoro-1-methoxy-3-propan-2-ylbenzene;1-methyl-4-(trifluoromethoxy)benzene |
| SMILES | CC.COc1cccc(C(C)C)c1F.Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H13FO.C8H7F3O.C2H6/c1-7(2)8-5-4-6-9(12-3)10(8)11;1-6-2-4-7(5-3-6)12-8(9,10)11;1-2/h4-7H,1-3H3;2-5H,1H3;1-2H3 |
| InChIKey | YCUCAXRHZIXANI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |