C15H13F4NO2 — CID 171257315
2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluoro-6-methylphenol (PubChem CID 171257315) has the molecular formula C15H13F4NO2 and a molecular weight of 315.27 g/mol. Its IUPAC name is 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluoro-6-methylphenol.
| Compound Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluoro-6-methylphenol |
|---|---|
| PubChem CID | 171257315 |
| Molecular Formula | C15H13F4NO2 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-fluoro-6-methylphenol |
| SMILES | Cc1ccc(F)c([C@H](N)c2ccc(OC(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C15H13F4NO2/c1-8-2-7-11(16)12(14(8)21)13(20)9-3-5-10(6-4-9)22-15(17,18)19/h2-7,13,21H,20H2,1H3/t13-/m1/s1 |
| InChIKey | YBZMVUAVLJSUKP-CYBMUJFWSA-N |
| XLogP | 3.79 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|