C14H9ClF5NO — CID 171249515
(R)-(2-chloro-3,6-difluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171249515) has the molecular formula C14H9ClF5NO and a molecular weight of 337.68 g/mol. Its IUPAC name is (R)-(2-chloro-3,6-difluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (R)-(2-chloro-3,6-difluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171249515 |
| Molecular Formula | C14H9ClF5NO |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (R)-(2-chloro-3,6-difluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C14H9ClF5NO/c15-12-10(17)6-5-9(16)11(12)13(21)7-1-3-8(4-2-7)22-14(18,19)20/h1-6,13H,21H2/t13-/m1/s1 |
| InChIKey | GJOJEGXXECFTHI-CYBMUJFWSA-N |
| XLogP | 4.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|