C14H10ClF4NO — CID 171241069
(S)-(2-chloro-4-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171241069) has the molecular formula C14H10ClF4NO and a molecular weight of 319.69 g/mol. Its IUPAC name is (S)-(2-chloro-4-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (S)-(2-chloro-4-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171241069 |
| Molecular Formula | C14H10ClF4NO |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | (S)-(2-chloro-4-fluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | N[C@@H](c1ccc(OC(F)(F)F)cc1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H10ClF4NO/c15-12-7-9(16)3-6-11(12)13(20)8-1-4-10(5-2-8)21-14(17,18)19/h1-7,13H,20H2/t13-/m0/s1 |
| InChIKey | IAZNHKSLNBDAGV-ZDUSSCGKSA-N |
| XLogP | 4.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |