C17H19ClF3NO — CID 171239714
(R)-(4-propan-2-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride (PubChem CID 171239714) has the molecular formula C17H19ClF3NO and a molecular weight of 345.79 g/mol. Its IUPAC name is (R)-(4-propan-2-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride.
| Compound Name | (R)-(4-propan-2-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171239714 |
| Molecular Formula | C17H19ClF3NO |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (R)-(4-propan-2-ylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
| SMILES | CC(C)c1ccc([C@@H](N)c2ccc(OC(F)(F)F)cc2)cc1.Cl |
| InChI | InChI=1S/C17H18F3NO.ClH/c1-11(2)12-3-5-13(6-4-12)16(21)14-7-9-15(10-8-14)22-17(18,19)20;/h3-11,16H,21H2,1-2H3;1H/t16-;/m1./s1 |
| InChIKey | CVZBHRLSIZEEGL-PKLMIRHRSA-N |
| XLogP | 5.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |