C18H20F3NO — CID 171240272
(R)-(4-tert-butylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171240272) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is (R)-(4-tert-butylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (R)-(4-tert-butylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171240272 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (R)-(4-tert-butylphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CC(C)(C)c1ccc([C@@H](N)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H20F3NO/c1-17(2,3)14-8-4-12(5-9-14)16(22)13-6-10-15(11-7-13)23-18(19,20)21/h4-11,16H,22H2,1-3H3/t16-/m1/s1 |
| InChIKey | XKGOJUKRPMRVCL-MRXNPFEDSA-N |
| XLogP | 4.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |