C22H28F3NO2 — CID 171240292
2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-ditert-butylphenol (PubChem CID 171240292) has the molecular formula C22H28F3NO2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 171240292 |
| Molecular Formula | C22H28F3NO2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc([C@@H](N)c2ccc(OC(F)(F)F)cc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H28F3NO2/c1-20(2,3)14-11-16(19(27)17(12-14)21(4,5)6)18(26)13-7-9-15(10-8-13)28-22(23,24)25/h7-12,18,27H,26H2,1-6H3/t18-/m0/s1 |
| InChIKey | PZJNPUQUXXZOSU-SFHVURJKSA-N |
| XLogP | 5.93 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|