C14H10BrClF5NO2 — CID 171257942
6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-2,3-difluorophenol;hydrochloride (PubChem CID 171257942) has the molecular formula C14H10BrClF5NO2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-2,3-difluorophenol;hydrochloride.
| Compound Name | 6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-2,3-difluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257942 |
| Molecular Formula | C14H10BrClF5NO2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 432.95 |
| IUPAC Name | 6-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-2,3-difluorophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(OC(F)(F)F)cc1)c1cc(Br)c(F)c(F)c1O |
| InChI | InChI=1S/C14H9BrF5NO2.ClH/c15-9-5-8(13(22)11(17)10(9)16)12(21)6-1-3-7(4-2-6)23-14(18,19)20;/h1-5,12,22H,21H2;1H/t12-;/m1./s1 |
| InChIKey | IDZOQNNSPSOTLI-UTONKHPSSA-N |
| XLogP | 4.80 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|