C16H16F3NO4 — CID 171246193
4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,6-dimethoxyphenol (PubChem CID 171246193) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is 4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 171246193 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc([C@H](N)c2ccc(OC(F)(F)F)cc2)cc(OC)c1O |
| InChI | InChI=1S/C16H16F3NO4/c1-22-12-7-10(8-13(23-2)15(12)21)14(20)9-3-5-11(6-4-9)24-16(17,18)19/h3-8,14,21H,20H2,1-2H3/t14-/m1/s1 |
| InChIKey | VKRHDPWVDOFLPY-CQSZACIVSA-N |
| XLogP | 3.36 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |