C15H14BrClF3NO2 — CID 171248315
(R)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride (PubChem CID 171248315) has the molecular formula C15H14BrClF3NO2 and a molecular weight of 412.63 g/mol. Its IUPAC name is (R)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride.
| Compound Name | (R)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171248315 |
| Molecular Formula | C15H14BrClF3NO2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | (R)-(3-bromo-4-methoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
| SMILES | COc1ccc([C@H](N)c2ccc(OC(F)(F)F)cc2)cc1Br.Cl |
| InChI | InChI=1S/C15H13BrF3NO2.ClH/c1-21-13-7-4-10(8-12(13)16)14(20)9-2-5-11(6-3-9)22-15(17,18)19;/h2-8,14H,20H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | FSYWMEWVLFFEPW-PFEQFJNWSA-N |
| XLogP | 4.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |