C16H16F3NO3 — CID 171246015
(R)-(3,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171246015) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is (R)-(3,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (R)-(3,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171246015 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (R)-(3,4-dimethoxyphenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | COc1ccc([C@H](N)c2ccc(OC(F)(F)F)cc2)cc1OC |
| InChI | InChI=1S/C16H16F3NO3/c1-21-13-8-5-11(9-14(13)22-2)15(20)10-3-6-12(7-4-10)23-16(17,18)19/h3-9,15H,20H2,1-2H3/t15-/m1/s1 |
| InChIKey | FRHCLWDKUGWJAL-OAHLLOKOSA-N |
| XLogP | 3.65 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |