C15H11F6NO2 — CID 171258095
2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethyl)phenol (PubChem CID 171258095) has the molecular formula C15H11F6NO2 and a molecular weight of 351.25 g/mol. Its IUPAC name is 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethyl)phenol.
| Compound Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 171258095 |
| Molecular Formula | C15H11F6NO2 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethyl)phenol |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C15H11F6NO2/c16-14(17,18)9-3-6-12(23)11(7-9)13(22)8-1-4-10(5-2-8)24-15(19,20)21/h1-7,13,23H,22H2/t13-/m1/s1 |
| InChIKey | VENHGUDOUDZBTP-CYBMUJFWSA-N |
| XLogP | 4.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|