C15H10BrF6NO — CID 171242075
(S)-[2-bromo-5-(trifluoromethyl)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171242075) has the molecular formula C15H10BrF6NO and a molecular weight of 414.14 g/mol. Its IUPAC name is (S)-[2-bromo-5-(trifluoromethyl)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (S)-[2-bromo-5-(trifluoromethyl)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171242075 |
| Molecular Formula | C15H10BrF6NO |
| Molecular Weight | 414.14 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | (S)-[2-bromo-5-(trifluoromethyl)phenyl]-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | N[C@@H](c1ccc(OC(F)(F)F)cc1)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C15H10BrF6NO/c16-12-6-3-9(14(17,18)19)7-11(12)13(23)8-1-4-10(5-2-8)24-15(20,21)22/h1-7,13H,23H2/t13-/m0/s1 |
| InChIKey | NBIAUQXZPWADHI-ZDUSSCGKSA-N |
| XLogP | 5.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.14 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |