C17H20F3NO2Si — CID 171242116
(S)-[4-(trifluoromethoxy)phenyl]-(4-trimethylsilyloxyphenyl)methanamine (PubChem CID 171242116) has the molecular formula C17H20F3NO2Si and a molecular weight of 355.43 g/mol. Its IUPAC name is (S)-[4-(trifluoromethoxy)phenyl]-(4-trimethylsilyloxyphenyl)methanamine.
| Compound Name | (S)-[4-(trifluoromethoxy)phenyl]-(4-trimethylsilyloxyphenyl)methanamine |
|---|---|
| PubChem CID | 171242116 |
| Molecular Formula | C17H20F3NO2Si |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (S)-[4-(trifluoromethoxy)phenyl]-(4-trimethylsilyloxyphenyl)methanamine |
| SMILES | C[Si](C)(C)Oc1ccc([C@@H](N)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H20F3NO2Si/c1-24(2,3)23-15-10-6-13(7-11-15)16(21)12-4-8-14(9-5-12)22-17(18,19)20/h4-11,16H,21H2,1-3H3/t16-/m0/s1 |
| InChIKey | UHMYCUHUSIGXKQ-INIZCTEOSA-N |
| XLogP | 4.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|