C11H17F2NOSi — CID 171248838
(1S)-2,2-difluoro-1-(4-trimethylsilyloxyphenyl)ethanamine (PubChem CID 171248838) has the molecular formula C11H17F2NOSi and a molecular weight of 245.35 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-(4-trimethylsilyloxyphenyl)ethanamine.
| Compound Name | (1S)-2,2-difluoro-1-(4-trimethylsilyloxyphenyl)ethanamine |
|---|---|
| PubChem CID | 171248838 |
| Molecular Formula | C11H17F2NOSi |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (1S)-2,2-difluoro-1-(4-trimethylsilyloxyphenyl)ethanamine |
| SMILES | C[Si](C)(C)Oc1ccc([C@H](N)C(F)F)cc1 |
| InChI | InChI=1S/C11H17F2NOSi/c1-16(2,3)15-9-6-4-8(5-7-9)10(14)11(12)13/h4-7,10-11H,14H2,1-3H3/t10-/m0/s1 |
| InChIKey | XWNAGSBOWZUDDO-JTQLQIEISA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|