C14H23ClFNO3Si — CID 171248851
ethyl (3S)-3-amino-2-fluoro-3-(4-trimethylsilyloxyphenyl)propanoate;hydrochloride (PubChem CID 171248851) has the molecular formula C14H23ClFNO3Si and a molecular weight of 335.88 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(4-trimethylsilyloxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(4-trimethylsilyloxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171248851 |
| Molecular Formula | C14H23ClFNO3Si |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(4-trimethylsilyloxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(O[Si](C)(C)C)cc1.Cl |
| InChI | InChI=1S/C14H22FNO3Si.ClH/c1-5-18-14(17)12(15)13(16)10-6-8-11(9-7-10)19-20(2,3)4;/h6-9,12-13H,5,16H2,1-4H3;1H/t12?,13-;/m0./s1 |
| InChIKey | PIBASMDLMUKZDV-ZEDZUCNESA-N |
| XLogP | 3.22 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|