C12H15ClF3NO3 — CID 171241697
ethyl (3R)-3-amino-3-[4-(difluoromethoxy)phenyl]-2-fluoropropanoate;hydrochloride (PubChem CID 171241697) has the molecular formula C12H15ClF3NO3 and a molecular weight of 313.70 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-[4-(difluoromethoxy)phenyl]-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-3-[4-(difluoromethoxy)phenyl]-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171241697 |
| Molecular Formula | C12H15ClF3NO3 |
| Molecular Weight | 313.70 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | ethyl (3R)-3-amino-3-[4-(difluoromethoxy)phenyl]-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@H](N)c1ccc(OC(F)F)cc1.Cl |
| InChI | InChI=1S/C12H14F3NO3.ClH/c1-2-18-11(17)9(13)10(16)7-3-5-8(6-4-7)19-12(14)15;/h3-6,9-10,12H,2,16H2,1H3;1H/t9?,10-;/m1./s1 |
| InChIKey | DNHJXXCIIYWGTM-FJYJDOHQSA-N |
| XLogP | 2.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |