C15H16FNO2 — CID 171240068
ethyl (3R)-3-amino-2-fluoro-3-naphthalen-2-ylpropanoate (PubChem CID 171240068) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-naphthalen-2-ylpropanoate.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 171240068 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-naphthalen-2-ylpropanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16FNO2/c1-2-19-15(18)13(16)14(17)12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13-14H,2,17H2,1H3/t13?,14-/m1/s1 |
| InChIKey | WTBJYAWJIICKQZ-ARLHGKGLSA-N |
| XLogP | 2.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |